C20H27FN6O3Si — CID 66824273
3-(fluoromethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidine-1-carboxylic acid (PubChem CID 66824273) has the molecular formula C20H27FN6O3Si and a molecular weight of 446.56 g/mol. Its IUPAC name is 3-(fluoromethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidine-1-carboxylic acid.
| Compound Name | 3-(fluoromethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66824273 |
| Molecular Formula | C20H27FN6O3Si |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3-(fluoromethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidine-1-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4(CF)CN(C(=O)O)C4)c3)ncnc21 |
| InChI | InChI=1S/C20H27FN6O3Si/c1-31(2,3)7-6-30-14-25-5-4-16-17(22-13-23-18(16)25)15-8-24-27(9-15)20(10-21)11-26(12-20)19(28)29/h4-5,8-9,13H,6-7,10-12,14H2,1-3H3,(H,28,29) |
| InChIKey | JKLFVULKTOMWKO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|