C28H45N7O3Si — CID 58181012
tert-butyl 4-[2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butyl]piperazine-1-carboxylate (PubChem CID 58181012) has the molecular formula C28H45N7O3Si and a molecular weight of 555.80 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58181012 |
| Molecular Formula | C28H45N7O3Si |
| Molecular Weight | 555.80 g/mol |
| Exact Mass | 555.34 |
| IUPAC Name | tert-butyl 4-[2-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butyl]piperazine-1-carboxylate |
| SMILES | CCC(CN1CCN(C(=O)OC(C)(C)C)CC1)n1cc(-c2ncnc3c2ccn3COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C28H45N7O3Si/c1-8-23(19-32-11-13-33(14-12-32)27(36)38-28(2,3)4)35-18-22(17-31-35)25-24-9-10-34(26(24)30-20-29-25)21-37-15-16-39(5,6)7/h9-10,17-18,20,23H,8,11-16,19,21H2,1-7H3 |
| InChIKey | IUJAOJBXGQRSJT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.80 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|