C30H41N7O3Si — CID 67054982
benzyl 4-[1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propan-2-yl]piperazine-1-carboxylate (PubChem CID 67054982) has the molecular formula C30H41N7O3Si and a molecular weight of 575.79 g/mol. Its IUPAC name is benzyl 4-[1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propan-2-yl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propan-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67054982 |
| Molecular Formula | C30H41N7O3Si |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | benzyl 4-[1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propan-2-yl]piperazine-1-carboxylate |
| SMILES | CC(Cn1cc(-c2ncnc3c2ccn3COCC[Si](C)(C)C)cn1)N1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C30H41N7O3Si/c1-24(34-12-14-35(15-13-34)30(38)40-21-25-8-6-5-7-9-25)19-37-20-26(18-33-37)28-27-10-11-36(29(27)32-22-31-28)23-39-16-17-41(2,3)4/h5-11,18,20,22,24H,12-17,19,21,23H2,1-4H3 |
| InChIKey | SDTMRHOSAJKABL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 90.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|