C21H30N6OSSi — CID 57477648
5-methylsulfanyl-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]pentanenitrile (PubChem CID 57477648) has the molecular formula C21H30N6OSSi and a molecular weight of 442.67 g/mol. Its IUPAC name is 5-methylsulfanyl-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]pentanenitrile.
| Compound Name | 5-methylsulfanyl-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 57477648 |
| Molecular Formula | C21H30N6OSSi |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 5-methylsulfanyl-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]pentanenitrile |
| SMILES | CSCCC(CC#N)n1cc(-c2ncnc3c2ccn3COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C21H30N6OSSi/c1-29-11-7-18(5-8-22)27-14-17(13-25-27)20-19-6-9-26(21(19)24-15-23-20)16-28-10-12-30(2,3)4/h6,9,13-15,18H,5,7,10-12,16H2,1-4H3 |
| InChIKey | AFVXNSDTVARYSX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 81.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|