C30H36N8OSi — CID 59589079
3-[(1S)-3-(1H-pyrrolo[2,3-b]pyridin-6-yl)cyclopentyl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile (PubChem CID 59589079) has the molecular formula C30H36N8OSi and a molecular weight of 552.76 g/mol. Its IUPAC name is 3-[(1S)-3-(1H-pyrrolo[2,3-b]pyridin-6-yl)cyclopentyl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile.
| Compound Name | 3-[(1S)-3-(1H-pyrrolo[2,3-b]pyridin-6-yl)cyclopentyl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 59589079 |
| Molecular Formula | C30H36N8OSi |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 3-[(1S)-3-(1H-pyrrolo[2,3-b]pyridin-6-yl)cyclopentyl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CC#N)[C@H]4CCC(c5ccc6cc[nH]c6n5)C4)c3)ncnc21 |
| InChI | InChI=1S/C30H36N8OSi/c1-40(2,3)15-14-39-20-37-13-10-25-28(33-19-34-30(25)37)24-17-35-38(18-24)27(8-11-31)23-5-4-22(16-23)26-7-6-21-9-12-32-29(21)36-26/h6-7,9-10,12-13,17-19,22-23,27H,4-5,8,14-16,20H2,1-3H3,(H,32,36)/t22?,23-,27?/m0/s1 |
| InChIKey | HDJWEBHPBOVNMH-CPXZFZLSSA-N |
| XLogP | 6.52 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|