C26H37N7O3Si — CID 67957320
4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile (PubChem CID 67957320) has the molecular formula C26H37N7O3Si and a molecular weight of 523.71 g/mol. Its IUPAC name is 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile.
| Compound Name | 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 67957320 |
| Molecular Formula | C26H37N7O3Si |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CC#N)CN4CCC5(CC4)OCCO5)c3)ncnc21 |
| InChI | InChI=1S/C26H37N7O3Si/c1-37(2,3)15-14-34-20-32-9-5-23-24(28-19-29-25(23)32)21-16-30-33(17-21)22(4-8-27)18-31-10-6-26(7-11-31)35-12-13-36-26/h5,9,16-17,19,22H,4,6-7,10-15,18,20H2,1-3H3 |
| InChIKey | YECNLAIBEFGFMI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 103.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|