C28H40N6O3Si — CID 66820748
tert-butyl 3-[2-cyano-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidine-1-carboxylate (PubChem CID 66820748) has the molecular formula C28H40N6O3Si and a molecular weight of 536.75 g/mol. Its IUPAC name is tert-butyl 3-[2-cyano-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-cyano-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66820748 |
| Molecular Formula | C28H40N6O3Si |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | tert-butyl 3-[2-cyano-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(CC#N)n2ccc(-c3ncnc4c3ccn4COCC[Si](C)(C)C)c2)C1 |
| InChI | InChI=1S/C28H40N6O3Si/c1-28(2,3)37-27(35)33-13-8-21(17-33)24(7-11-29)32-12-9-22(18-32)25-23-10-14-34(26(23)31-19-30-25)20-36-15-16-38(4,5)6/h9-10,12,14,18-19,21,24H,7-8,13,15-17,20H2,1-6H3 |
| InChIKey | VBKGGVIWWIPZPS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 98.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|