C28H41N7O3Si — CID 141450609
ethyl 3-[[1-(2-cyano-1-cyclopentylethyl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-3-yl]amino]propanoate (PubChem CID 141450609) has the molecular formula C28H41N7O3Si and a molecular weight of 551.77 g/mol. Its IUPAC name is ethyl 3-[[1-(2-cyano-1-cyclopentylethyl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-3-yl]amino]propanoate.
| Compound Name | ethyl 3-[[1-(2-cyano-1-cyclopentylethyl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-3-yl]amino]propanoate |
|---|---|
| PubChem CID | 141450609 |
| Molecular Formula | C28H41N7O3Si |
| Molecular Weight | 551.77 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | ethyl 3-[[1-(2-cyano-1-cyclopentylethyl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-3-yl]amino]propanoate |
| SMILES | CCOC(=O)CCNc1nn(C(CC#N)C2CCCC2)cc1-c1ncnc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C28H41N7O3Si/c1-5-38-25(36)11-14-30-27-23(18-35(33-27)24(10-13-29)21-8-6-7-9-21)26-22-12-15-34(28(22)32-19-31-26)20-37-16-17-39(2,3)4/h12,15,18-19,21,24H,5-11,14,16-17,20H2,1-4H3,(H,30,33) |
| InChIKey | BFFPIAXYEPCQNW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.77 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|