C21H26FN7O2S — CID 145100300
[4-[1-(2-cyano-1-cyclopentylethyl)-3-(3-oxopropylamino)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypofluorite;methanol (PubChem CID 145100300) has the molecular formula C21H26FN7O2S and a molecular weight of 459.55 g/mol. Its IUPAC name is [4-[1-(2-cyano-1-cyclopentylethyl)-3-(3-oxopropylamino)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypofluorite;methanol.
| Compound Name | [4-[1-(2-cyano-1-cyclopentylethyl)-3-(3-oxopropylamino)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypofluorite;methanol |
|---|---|
| PubChem CID | 145100300 |
| Molecular Formula | C21H26FN7O2S |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | [4-[1-(2-cyano-1-cyclopentylethyl)-3-(3-oxopropylamino)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypofluorite;methanol |
| SMILES | CO.N#CCC(C1CCCC1)n1cc(-c2ncnc3c2ccn3SF)c(NCCC=O)n1 |
| InChI | InChI=1S/C20H22FN7OS.CH4O/c21-30-28-10-7-15-18(24-13-25-20(15)28)16-12-27(26-19(16)23-9-3-11-29)17(6-8-22)14-4-1-2-5-14;1-2/h7,10-14,17H,1-6,9H2,(H,23,26);2H,1H3 |
| InChIKey | XIXLNMBWSQSMON-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|