C28H39N7O3Si — CID 141450636
3-[[1-(2-cyano-1-cyclopentylethyl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-3-yl]amino]cyclobutane-1-carboxylic acid (PubChem CID 141450636) has the molecular formula C28H39N7O3Si and a molecular weight of 549.75 g/mol. Its IUPAC name is 3-[[1-(2-cyano-1-cyclopentylethyl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-3-yl]amino]cyclobutane-1-carboxylic acid.
| Compound Name | 3-[[1-(2-cyano-1-cyclopentylethyl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-3-yl]amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 141450636 |
| Molecular Formula | C28H39N7O3Si |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | 3-[[1-(2-cyano-1-cyclopentylethyl)-4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-3-yl]amino]cyclobutane-1-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cn(C(CC#N)C4CCCC4)nc3NC3CC(C(=O)O)C3)ncnc21 |
| InChI | InChI=1S/C28H39N7O3Si/c1-39(2,3)13-12-38-18-34-11-9-22-25(30-17-31-27(22)34)23-16-35(24(8-10-29)19-6-4-5-7-19)33-26(23)32-21-14-20(15-21)28(36)37/h9,11,16-17,19-21,24H,4-8,12-15,18H2,1-3H3,(H,32,33)(H,36,37) |
| InChIKey | FMOLXKYGPAPCOD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|