C14H19ClN2O2Si — CID 86676739
4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde (PubChem CID 86676739) has the molecular formula C14H19ClN2O2Si and a molecular weight of 310.86 g/mol. Its IUPAC name is 4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde.
| Compound Name | 4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 86676739 |
| Molecular Formula | C14H19ClN2O2Si |
| Molecular Weight | 310.86 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 4-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Cl)c(C=O)cnc21 |
| InChI | InChI=1S/C14H19ClN2O2Si/c1-20(2,3)7-6-19-10-17-5-4-12-13(15)11(9-18)8-16-14(12)17/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | DUDAYGHZXFYQRC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.86 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|