C22H35ClN4O2Si — CID 59292010
4-chloro-N'-cyclooctyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbohydrazide (PubChem CID 59292010) has the molecular formula C22H35ClN4O2Si and a molecular weight of 451.09 g/mol. Its IUPAC name is 4-chloro-N'-cyclooctyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbohydrazide.
| Compound Name | 4-chloro-N'-cyclooctyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbohydrazide |
|---|---|
| PubChem CID | 59292010 |
| Molecular Formula | C22H35ClN4O2Si |
| Molecular Weight | 451.09 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 4-chloro-N'-cyclooctyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbohydrazide |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Cl)c(C(=O)NNC3CCCCCCC3)cnc21 |
| InChI | InChI=1S/C22H35ClN4O2Si/c1-30(2,3)14-13-29-16-27-12-11-18-20(23)19(15-24-21(18)27)22(28)26-25-17-9-7-5-4-6-8-10-17/h11-12,15,17,25H,4-10,13-14,16H2,1-3H3,(H,26,28) |
| InChIKey | WSNZUSUXKYXWAW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.09 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|