C22H34N4O2Si — CID 90335875
13-cyclohexyl-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one (PubChem CID 90335875) has the molecular formula C22H34N4O2Si and a molecular weight of 414.63 g/mol. Its IUPAC name is 13-cyclohexyl-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one.
| Compound Name | 13-cyclohexyl-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 90335875 |
| Molecular Formula | C22H34N4O2Si |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 13-cyclohexyl-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
| SMILES | CN1CN(C2CCCCC2)c2c(cnc3c2ccn3COCC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C22H34N4O2Si/c1-24-15-26(17-8-6-5-7-9-17)20-18-10-11-25(16-28-12-13-29(2,3)4)21(18)23-14-19(20)22(24)27/h10-11,14,17H,5-9,12-13,15-16H2,1-4H3 |
| InChIKey | YJPMAESYEBBVJB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|