C29H45F2N5O4Si — CID 123452854
tert-butyl N-(2,2-difluoroethyl)-N-[[4-[10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]carbamate (PubChem CID 123452854) has the molecular formula C29H45F2N5O4Si and a molecular weight of 593.79 g/mol. Its IUPAC name is tert-butyl N-(2,2-difluoroethyl)-N-[[4-[10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-(2,2-difluoroethyl)-N-[[4-[10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 123452854 |
| Molecular Formula | C29H45F2N5O4Si |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.32 |
| IUPAC Name | tert-butyl N-(2,2-difluoroethyl)-N-[[4-[10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC(F)F)CC1CCC(N2CNC(=O)c3cnc4c(ccn4COCC[Si](C)(C)C)c32)CC1 |
| InChI | InChI=1S/C29H45F2N5O4Si/c1-29(2,3)40-28(38)35(17-24(30)31)16-20-7-9-21(10-8-20)36-18-33-27(37)23-15-32-26-22(25(23)36)11-12-34(26)19-39-13-14-41(4,5)6/h11-12,15,20-21,24H,7-10,13-14,16-19H2,1-6H3,(H,33,37) |
| InChIKey | LEBLOGGWXVPMMN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|