C25H38N6O2Si — CID 123190683
2-[[4-[11-methyl-10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methylamino]acetonitrile (PubChem CID 123190683) has the molecular formula C25H38N6O2Si and a molecular weight of 482.71 g/mol. Its IUPAC name is 2-[[4-[11-methyl-10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methylamino]acetonitrile.
| Compound Name | 2-[[4-[11-methyl-10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methylamino]acetonitrile |
|---|---|
| PubChem CID | 123190683 |
| Molecular Formula | C25H38N6O2Si |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 2-[[4-[11-methyl-10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methylamino]acetonitrile |
| SMILES | CN1CN(C2CCC(CNCC#N)CC2)c2c(cnc3c2ccn3COCC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C25H38N6O2Si/c1-29-17-31(20-7-5-19(6-8-20)15-27-11-10-26)23-21-9-12-30(18-33-13-14-34(2,3)4)24(21)28-16-22(23)25(29)32/h9,12,16,19-20,27H,5-8,11,13-15,17-18H2,1-4H3 |
| InChIKey | DREQIBKGDBOILS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 86.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|