C17H23N5O — CID 144680913
13-[4-(aminomethyl)cyclohexyl]-11-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one (PubChem CID 144680913) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is 13-[4-(aminomethyl)cyclohexyl]-11-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one.
| Compound Name | 13-[4-(aminomethyl)cyclohexyl]-11-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 144680913 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 13-[4-(aminomethyl)cyclohexyl]-11-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
| SMILES | CN1CN(C2CCC(CN)CC2)c2c(cnc3[nH]ccc23)C1=O |
| InChI | InChI=1S/C17H23N5O/c1-21-10-22(12-4-2-11(8-18)3-5-12)15-13-6-7-19-16(13)20-9-14(15)17(21)23/h6-7,9,11-12H,2-5,8,10,18H2,1H3,(H,19,20) |
| InChIKey | FWOMDQCIYCBPRT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |