C18H27N5OS — CID 144680882
13-cyclohexyl-11-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one;N-methylsulfanylmethanamine (PubChem CID 144680882) has the molecular formula C18H27N5OS and a molecular weight of 361.52 g/mol. Its IUPAC name is 13-cyclohexyl-11-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one;N-methylsulfanylmethanamine.
| Compound Name | 13-cyclohexyl-11-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one;N-methylsulfanylmethanamine |
|---|---|
| PubChem CID | 144680882 |
| Molecular Formula | C18H27N5OS |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 13-cyclohexyl-11-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one;N-methylsulfanylmethanamine |
| SMILES | CN1CN(C2CCCCC2)c2c(cnc3[nH]ccc23)C1=O.CNSC |
| InChI | InChI=1S/C16H20N4O.C2H7NS/c1-19-10-20(11-5-3-2-4-6-11)14-12-7-8-17-15(12)18-9-13(14)16(19)21;1-3-4-2/h7-9,11H,2-6,10H2,1H3,(H,17,18);3H,1-2H3 |
| InChIKey | KSAVQPKYGBPVOC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|