C12H14N4 — CID 141161049
3-cyclobutyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene (PubChem CID 141161049) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-cyclobutyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene.
| Compound Name | 3-cyclobutyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene |
|---|---|
| PubChem CID | 141161049 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-cyclobutyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene |
| SMILES | c1cc2c3c(cnc2[nH]1)NCN3C1CCC1 |
| InChI | InChI=1S/C12H14N4/c1-2-8(3-1)16-7-15-10-6-14-12-9(11(10)16)4-5-13-12/h4-6,8,15H,1-3,7H2,(H,13,14) |
| InChIKey | CVUXKPXIHSPCFJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |