C15H22N4O — CID 162754090
ethane;3-(10-oxa-5,7,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclobutan-1-amine (PubChem CID 162754090) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is ethane;3-(10-oxa-5,7,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclobutan-1-amine.
| Compound Name | ethane;3-(10-oxa-5,7,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 162754090 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | ethane;3-(10-oxa-5,7,13-triazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclobutan-1-amine |
| SMILES | CC.NC1CC(N2CCOc3cnc4[nH]ccc4c32)C1 |
| InChI | InChI=1S/C13H16N4O.C2H6/c14-8-5-9(6-8)17-3-4-18-11-7-16-13-10(12(11)17)1-2-15-13;1-2/h1-2,7-9H,3-6,14H2,(H,15,16);1-2H3 |
| InChIKey | GNZNKOOTRGYIFN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |