C11H18N5O4P — CID 166437336
1-N-methyl-1-N-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclobutane-1,3-diamine;phosphoric acid (PubChem CID 166437336) has the molecular formula C11H18N5O4P and a molecular weight of 315.27 g/mol. Its IUPAC name is 1-N-methyl-1-N-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclobutane-1,3-diamine;phosphoric acid.
| Compound Name | 1-N-methyl-1-N-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclobutane-1,3-diamine;phosphoric acid |
|---|---|
| PubChem CID | 166437336 |
| Molecular Formula | C11H18N5O4P |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-N-methyl-1-N-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclobutane-1,3-diamine;phosphoric acid |
| SMILES | CN(c1ncnc2[nH]ccc12)C1CC(N)C1.O=P(O)(O)O |
| InChI | InChI=1S/C11H15N5.H3O4P/c1-16(8-4-7(12)5-8)11-9-2-3-13-10(9)14-6-15-11;1-5(2,3)4/h2-3,6-8H,4-5,12H2,1H3,(H,13,14,15);(H3,1,2,3,4) |
| InChIKey | ZZUUNNRFOTVSOA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|