C16H23FN4O2S — CID 118868867
N-[3-(4-fluorobutylsulfonylmethyl)cyclobutyl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 118868867) has the molecular formula C16H23FN4O2S and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[3-(4-fluorobutylsulfonylmethyl)cyclobutyl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[3-(4-fluorobutylsulfonylmethyl)cyclobutyl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118868867 |
| Molecular Formula | C16H23FN4O2S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[3-(4-fluorobutylsulfonylmethyl)cyclobutyl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CN(c1ncnc2[nH]ccc12)C1CC(CS(=O)(=O)CCCCF)C1 |
| InChI | InChI=1S/C16H23FN4O2S/c1-21(16-14-4-6-18-15(14)19-11-20-16)13-8-12(9-13)10-24(22,23)7-3-2-5-17/h4,6,11-13H,2-3,5,7-10H2,1H3,(H,18,19,20) |
| InChIKey | FLPGRFLJPKNKQT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|