C15H20N4 — CID 160618729
N-[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 160618729) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 160618729 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N-[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CN(c1ncnc2[nH]ccc12)C1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C15H20N4/c1-19(12-7-10-3-2-4-11(10)8-12)15-13-5-6-16-14(13)17-9-18-15/h5-6,9-12H,2-4,7-8H2,1H3,(H,16,17,18)/t10-,11+,12? |
| InChIKey | CBZNWPISBYYMSX-FOSCPWQOSA-N |
| XLogP | 2.97 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |