C14H18N5O2S- — CID 135190947
5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfinate (PubChem CID 135190947) has the molecular formula C14H18N5O2S- and a molecular weight of 320.40 g/mol. Its IUPAC name is 5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfinate.
| Compound Name | 5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfinate |
|---|---|
| PubChem CID | 135190947 |
| Molecular Formula | C14H18N5O2S- |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfinate |
| SMILES | CN(c1ncnc2[nH]ccc12)C1CC2CN(S(=O)[O-])CC2C1 |
| InChI | InChI=1S/C14H19N5O2S/c1-18(14-12-2-3-15-13(12)16-8-17-14)11-4-9-6-19(22(20)21)7-10(9)5-11/h2-3,8-11H,4-7H2,1H3,(H,20,21)(H,15,16,17)/p-1 |
| InChIKey | PRSWHNULOMKGSR-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|