C17H21N9O — CID 78136863
1-[5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2H-tetrazol-5-yl)ethanone (PubChem CID 78136863) has the molecular formula C17H21N9O and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-[5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2H-tetrazol-5-yl)ethanone.
| Compound Name | 1-[5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2H-tetrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 78136863 |
| Molecular Formula | C17H21N9O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2H-tetrazol-5-yl)ethanone |
| SMILES | CN(c1ncnc2[nH]ccc12)C1CC2CN(C(=O)Cc3nn[nH]n3)CC2C1 |
| InChI | InChI=1S/C17H21N9O/c1-25(17-13-2-3-18-16(13)19-9-20-17)12-4-10-7-26(8-11(10)5-12)15(27)6-14-21-23-24-22-14/h2-3,9-12H,4-8H2,1H3,(H,18,19,20)(H,21,22,23,24) |
| InChIKey | QDBOCSLEIBBQTH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |