C18H28N10O — CID 137148760
(3aS,6aR)-N-[(E)-N'-[amino(ethyl)amino]carbamimidoyl]-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 137148760) has the molecular formula C18H28N10O and a molecular weight of 400.49 g/mol. Its IUPAC name is (3aS,6aR)-N-[(E)-N'-[amino(ethyl)amino]carbamimidoyl]-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-N-[(E)-N'-[amino(ethyl)amino]carbamimidoyl]-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 137148760 |
| Molecular Formula | C18H28N10O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | (3aS,6aR)-N-[(E)-N'-[amino(ethyl)amino]carbamimidoyl]-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CCN(N)/N=C(\N)NC(=O)N1C[C@H]2CC(N(C)c3ncnc4[nH]ccc34)C[C@H]2C1 |
| InChI | InChI=1S/C18H28N10O/c1-3-28(20)25-17(19)24-18(29)27-8-11-6-13(7-12(11)9-27)26(2)16-14-4-5-21-15(14)22-10-23-16/h4-5,10-13H,3,6-9,20H2,1-2H3,(H,21,22,23)(H3,19,24,25,29)/t11-,12+,13? |
| InChIKey | OCEQAQZMULNAMY-FUNVUKJBSA-N |
| XLogP | 0.24 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|