C17H20N8OS — CID 78136864
5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-(1,3,4-thiadiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 78136864) has the molecular formula C17H20N8OS and a molecular weight of 384.47 g/mol. Its IUPAC name is 5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-(1,3,4-thiadiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | 5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-(1,3,4-thiadiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 78136864 |
| Molecular Formula | C17H20N8OS |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-(1,3,4-thiadiazol-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CN(c1ncnc2[nH]ccc12)C1CC2CN(C(=O)Nc3nncs3)CC2C1 |
| InChI | InChI=1S/C17H20N8OS/c1-24(15-13-2-3-18-14(13)19-8-20-15)12-4-10-6-25(7-11(10)5-12)17(26)22-16-23-21-9-27-16/h2-3,8-12H,4-7H2,1H3,(H,18,19,20)(H,22,23,26) |
| InChIKey | XXMRXZSCYMAWAX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |