C18H19Cl2N7 — CID 135191156
N-[(3aR)-2-(2,6-dichloropyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 135191156) has the molecular formula C18H19Cl2N7 and a molecular weight of 404.31 g/mol. Its IUPAC name is N-[(3aR)-2-(2,6-dichloropyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(3aR)-2-(2,6-dichloropyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 135191156 |
| Molecular Formula | C18H19Cl2N7 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-[(3aR)-2-(2,6-dichloropyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CN(c1ncnc2[nH]ccc12)C1CC2CN(c3cc(Cl)nc(Cl)n3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H19Cl2N7/c1-26(17-13-2-3-21-16(13)22-9-23-17)12-4-10-7-27(8-11(10)5-12)15-6-14(19)24-18(20)25-15/h2-3,6,9-12H,4-5,7-8H2,1H3,(H,21,22,23)/t10-,11?,12?/m0/s1 |
| InChIKey | BSKPMIBDRODETO-UNXYVOJBSA-N |
| XLogP | 3.41 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |