C25H40N4O4Si — CID 123788808
13-[4-(dimethoxymethyl)cyclohexyl]-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one (PubChem CID 123788808) has the molecular formula C25H40N4O4Si and a molecular weight of 488.71 g/mol. Its IUPAC name is 13-[4-(dimethoxymethyl)cyclohexyl]-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one.
| Compound Name | 13-[4-(dimethoxymethyl)cyclohexyl]-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 123788808 |
| Molecular Formula | C25H40N4O4Si |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 13-[4-(dimethoxymethyl)cyclohexyl]-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
| SMILES | COC(OC)C1CCC(N2CN(C)C(=O)c3cnc4c(ccn4COCC[Si](C)(C)C)c32)CC1 |
| InChI | InChI=1S/C25H40N4O4Si/c1-27-16-29(19-9-7-18(8-10-19)25(31-2)32-3)22-20-11-12-28(17-33-13-14-34(4,5)6)23(20)26-15-21(22)24(27)30/h11-12,15,18-19,25H,7-10,13-14,16-17H2,1-6H3 |
| InChIKey | QGFIZXSKPPFNEE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|