C24H37N4O4Si+ — CID 123176878
13-[4-[hydroxy(methoxy)methyl]cyclohexyl]-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11-triaza-13-azoniatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one (PubChem CID 123176878) has the molecular formula C24H37N4O4Si+ and a molecular weight of 473.67 g/mol. Its IUPAC name is 13-[4-[hydroxy(methoxy)methyl]cyclohexyl]-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11-triaza-13-azoniatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one.
| Compound Name | 13-[4-[hydroxy(methoxy)methyl]cyclohexyl]-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11-triaza-13-azoniatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
|---|---|
| PubChem CID | 123176878 |
| Molecular Formula | C24H37N4O4Si+ |
| Molecular Weight | 473.67 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 13-[4-[hydroxy(methoxy)methyl]cyclohexyl]-11-methyl-5-(2-trimethylsilylethoxymethyl)-5,7,11-triaza-13-azoniatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
| SMILES | COC(O)C1CCC([n+]2cn(C)c(=O)c3cnc4c(ccn4COCC[Si](C)(C)C)c32)CC1 |
| InChI | InChI=1S/C24H37N4O4Si/c1-26-15-28(18-8-6-17(7-9-18)24(30)31-2)21-19-10-11-27(16-32-12-13-33(3,4)5)22(19)25-14-20(21)23(26)29/h10-11,14-15,17-18,24,30H,6-9,12-13,16H2,1-5H3/q+1 |
| InChIKey | DQMICTFUVWUYBU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|