C23H29N3O4Si — CID 175821459
2-[4-(2-trimethylsilylethoxymethyl)-13-oxa-2,4,10-triazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-10-yl]benzoic acid (PubChem CID 175821459) has the molecular formula C23H29N3O4Si and a molecular weight of 439.59 g/mol. Its IUPAC name is 2-[4-(2-trimethylsilylethoxymethyl)-13-oxa-2,4,10-triazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-10-yl]benzoic acid.
| Compound Name | 2-[4-(2-trimethylsilylethoxymethyl)-13-oxa-2,4,10-triazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-10-yl]benzoic acid |
|---|---|
| PubChem CID | 175821459 |
| Molecular Formula | C23H29N3O4Si |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2-[4-(2-trimethylsilylethoxymethyl)-13-oxa-2,4,10-triazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-10-yl]benzoic acid |
| SMILES | C[Si](C)(C)CCOCn1ccc2cc3c(nc21)COCCN3c1ccccc1C(=O)O |
| InChI | InChI=1S/C23H29N3O4Si/c1-31(2,3)13-12-30-16-25-9-8-17-14-21-19(24-22(17)25)15-29-11-10-26(21)20-7-5-4-6-18(20)23(27)28/h4-9,14H,10-13,15-16H2,1-3H3,(H,27,28) |
| InChIKey | TUYKWBSJKSBSRG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|