C23H34BrN5O4Si — CID 89456231
[1-[2-[[4-bromo-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]phenyl]piperidin-4-yl]-methylcarbamic acid (PubChem CID 89456231) has the molecular formula C23H34BrN5O4Si and a molecular weight of 552.55 g/mol. Its IUPAC name is [1-[2-[[4-bromo-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]phenyl]piperidin-4-yl]-methylcarbamic acid.
| Compound Name | [1-[2-[[4-bromo-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]phenyl]piperidin-4-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 89456231 |
| Molecular Formula | C23H34BrN5O4Si |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | [1-[2-[[4-bromo-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]phenyl]piperidin-4-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1CCN(c2ccccc2NC(=O)c2nc(Br)cn2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C23H34BrN5O4Si/c1-27(23(31)32)17-9-11-28(12-10-17)19-8-6-5-7-18(19)25-22(30)21-26-20(24)15-29(21)16-33-13-14-34(2,3)4/h5-8,15,17H,9-14,16H2,1-4H3,(H,25,30)(H,31,32) |
| InChIKey | QQLCZJGCTBFKBJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|