C32H44ClFN6O4Si — CID 89456338
tert-butyl N-[1-[2-[[4-(2-chloro-6-methyl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-6-fluorophenyl]piperidin-3-yl]carbamate (PubChem CID 89456338) has the molecular formula C32H44ClFN6O4Si and a molecular weight of 659.28 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[[4-(2-chloro-6-methyl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-6-fluorophenyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[[4-(2-chloro-6-methyl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-6-fluorophenyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 89456338 |
| Molecular Formula | C32H44ClFN6O4Si |
| Molecular Weight | 659.28 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | tert-butyl N-[1-[2-[[4-(2-chloro-6-methyl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-6-fluorophenyl]piperidin-3-yl]carbamate |
| SMILES | Cc1cc(-c2cn(COCC[Si](C)(C)C)c(C(=O)Nc3cccc(F)c3N3CCCC(NC(=O)OC(C)(C)C)C3)n2)cc(Cl)n1 |
| InChI | InChI=1S/C32H44ClFN6O4Si/c1-21-16-22(17-27(33)35-21)26-19-40(20-43-14-15-45(5,6)7)29(37-26)30(41)38-25-12-8-11-24(34)28(25)39-13-9-10-23(18-39)36-31(42)44-32(2,3)4/h8,11-12,16-17,19,23H,9-10,13-15,18,20H2,1-7H3,(H,36,42)(H,38,41) |
| InChIKey | WTGHJXXCWIFECF-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.28 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|