C10H17BrN2O3Si — CID 89459246
4-bromo-5-deuterio-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylic acid (PubChem CID 89459246) has the molecular formula C10H17BrN2O3Si and a molecular weight of 322.25 g/mol. Its IUPAC name is 4-bromo-5-deuterio-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylic acid.
| Compound Name | 4-bromo-5-deuterio-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 89459246 |
| Molecular Formula | C10H17BrN2O3Si |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 4-bromo-5-deuterio-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylic acid |
| SMILES | [2H]c1c(Br)nc(C(=O)O)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C10H17BrN2O3Si/c1-17(2,3)5-4-16-7-13-6-8(11)12-9(13)10(14)15/h6H,4-5,7H2,1-3H3,(H,14,15)/i6D |
| InChIKey | XVGSIOJVIHXOIY-RAMDWTOOSA-N |
| XLogP | 2.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|