C10H19N3O2Si — CID 68592326
1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide (PubChem CID 68592326) has the molecular formula C10H19N3O2Si and a molecular weight of 241.37 g/mol. Its IUPAC name is 1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide.
| Compound Name | 1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide |
|---|---|
| PubChem CID | 68592326 |
| Molecular Formula | C10H19N3O2Si |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1ccnc1C(N)=O |
| InChI | InChI=1S/C10H19N3O2Si/c1-16(2,3)7-6-15-8-13-5-4-12-10(13)9(11)14/h4-5H,6-8H2,1-3H3,(H2,11,14) |
| InChIKey | BKFLUXBQUHVWRH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|