C10H19N3O2Si — CID 140658225
(NE)-N-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methylidene]hydroxylamine (PubChem CID 140658225) has the molecular formula C10H19N3O2Si and a molecular weight of 241.37 g/mol. Its IUPAC name is (NE)-N-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 140658225 |
| Molecular Formula | C10H19N3O2Si |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (NE)-N-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methylidene]hydroxylamine |
| SMILES | C[Si](C)(C)CCOCn1ccnc1/C=N/O |
| InChI | InChI=1S/C10H19N3O2Si/c1-16(2,3)7-6-15-9-13-5-4-11-10(13)8-12-14/h4-5,8,14H,6-7,9H2,1-3H3/b12-8+ |
| InChIKey | AEENDLLVCUQUNQ-XYOKQWHBSA-N |
| XLogP | 2.00 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|