C22H42N4O3Si2 — CID 68954118
3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]propan-1-ol (PubChem CID 68954118) has the molecular formula C22H42N4O3Si2 and a molecular weight of 466.78 g/mol. Its IUPAC name is 3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]propan-1-ol.
| Compound Name | 3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]propan-1-ol |
|---|---|
| PubChem CID | 68954118 |
| Molecular Formula | C22H42N4O3Si2 |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-[[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]propan-1-ol |
| SMILES | C[Si](C)(C)CCOCn1ccnc1CC(CO)Cc1nccn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H42N4O3Si2/c1-30(2,3)13-11-28-18-25-9-7-23-21(25)15-20(17-27)16-22-24-8-10-26(22)19-29-12-14-31(4,5)6/h7-10,20,27H,11-19H2,1-6H3 |
| InChIKey | LFAGJBDWWZUAQY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|