C18H26N4OSi — CID 11991092
2-[[2-[bis(1H-pyrrol-2-yl)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 11991092) has the molecular formula C18H26N4OSi and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-[[2-[bis(1H-pyrrol-2-yl)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[bis(1H-pyrrol-2-yl)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 11991092 |
| Molecular Formula | C18H26N4OSi |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[[2-[bis(1H-pyrrol-2-yl)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccnc1C(c1ccc[nH]1)c1ccc[nH]1 |
| InChI | InChI=1S/C18H26N4OSi/c1-24(2,3)13-12-23-14-22-11-10-21-18(22)17(15-6-4-8-19-15)16-7-5-9-20-16/h4-11,17,19-20H,12-14H2,1-3H3 |
| InChIKey | GRIXRPVPWTVGFD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|