C26H43BN4OSi — CID 11991095
2-[[2-[(1-dibutylboranylpyrrol-2-yl)-(1H-pyrrol-2-yl)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 11991095) has the molecular formula C26H43BN4OSi and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[[2-[(1-dibutylboranylpyrrol-2-yl)-(1H-pyrrol-2-yl)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[(1-dibutylboranylpyrrol-2-yl)-(1H-pyrrol-2-yl)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 11991095 |
| Molecular Formula | C26H43BN4OSi |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 2-[[2-[(1-dibutylboranylpyrrol-2-yl)-(1H-pyrrol-2-yl)methyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCCCB(CCCC)n1cccc1C(c1ccc[nH]1)c1nccn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H43BN4OSi/c1-6-8-14-27(15-9-7-2)31-18-11-13-24(31)25(23-12-10-16-28-23)26-29-17-19-30(26)22-32-20-21-33(3,4)5/h10-13,16-19,25,28H,6-9,14-15,20-22H2,1-5H3 |
| InChIKey | ZLJBFHUDUPPPDG-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|