C29H44N4O4Si — CID 10075975
1-[(2S)-2-[(2S)-2-[hydroxy-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-4-phenylbutan-1-one (PubChem CID 10075975) has the molecular formula C29H44N4O4Si and a molecular weight of 540.78 g/mol. Its IUPAC name is 1-[(2S)-2-[(2S)-2-[hydroxy-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[(2S)-2-[(2S)-2-[hydroxy-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 10075975 |
| Molecular Formula | C29H44N4O4Si |
| Molecular Weight | 540.78 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 1-[(2S)-2-[(2S)-2-[hydroxy-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-4-phenylbutan-1-one |
| SMILES | C[Si](C)(C)CCOCn1ccnc1C(O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C29H44N4O4Si/c1-38(2,3)21-20-37-22-31-19-16-30-28(31)27(35)24-13-8-18-33(24)29(36)25-14-9-17-32(25)26(34)15-7-12-23-10-5-4-6-11-23/h4-6,10-11,16,19,24-25,27,35H,7-9,12-15,17-18,20-22H2,1-3H3/t24-,25-,27?/m0/s1 |
| InChIKey | WGTLSZLOJMDGTA-MVAOMIMOSA-N |
| XLogP | 4.23 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|