C14H27NOSi — CID 13211466
2-[(2-butylpyrrol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 13211466) has the molecular formula C14H27NOSi and a molecular weight of 253.46 g/mol. Its IUPAC name is 2-[(2-butylpyrrol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2-butylpyrrol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 13211466 |
| Molecular Formula | C14H27NOSi |
| Molecular Weight | 253.46 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 2-[(2-butylpyrrol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | CCCCc1cccn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C14H27NOSi/c1-5-6-8-14-9-7-10-15(14)13-16-11-12-17(2,3)4/h7,9-10H,5-6,8,11-13H2,1-4H3 |
| InChIKey | LBAQNXUCQQAZMG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|