C16H25ClIN3OSi — CID 140692585
2-[(2-butyl-4-chloro-7-iodopyrrolo[3,2-d]pyrimidin-5-yl)methoxy]ethyl-trimethylsilane (PubChem CID 140692585) has the molecular formula C16H25ClIN3OSi and a molecular weight of 465.84 g/mol. Its IUPAC name is 2-[(2-butyl-4-chloro-7-iodopyrrolo[3,2-d]pyrimidin-5-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2-butyl-4-chloro-7-iodopyrrolo[3,2-d]pyrimidin-5-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140692585 |
| Molecular Formula | C16H25ClIN3OSi |
| Molecular Weight | 465.84 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 2-[(2-butyl-4-chloro-7-iodopyrrolo[3,2-d]pyrimidin-5-yl)methoxy]ethyl-trimethylsilane |
| SMILES | CCCCc1nc(Cl)c2c(n1)c(I)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H25ClIN3OSi/c1-5-6-7-13-19-14-12(18)10-21(15(14)16(17)20-13)11-22-8-9-23(2,3)4/h10H,5-9,11H2,1-4H3 |
| InChIKey | XOPGUDURHHQIOU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.84 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|