C26H47NOSiSn — CID 177464058
trimethyl-[2-[(3-tributylstannylindol-1-yl)methoxy]ethyl]silane (PubChem CID 177464058) has the molecular formula C26H47NOSiSn and a molecular weight of 536.47 g/mol. Its IUPAC name is trimethyl-[2-[(3-tributylstannylindol-1-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(3-tributylstannylindol-1-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 177464058 |
| Molecular Formula | C26H47NOSiSn |
| Molecular Weight | 536.47 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | trimethyl-[2-[(3-tributylstannylindol-1-yl)methoxy]ethyl]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cn(COCC[Si](C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C14H20NOSi.3C4H9.Sn/c1-17(2,3)11-10-16-12-15-9-8-13-6-4-5-7-14(13)15;3*1-3-4-2;/h4-7,9H,10-12H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | AVUYBJOUSDSDSP-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.47 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|