C29H55N3OSi2Sn — CID 22031298
trimethyl-[5-(4-tributylstannylphenyl)-3-(2-trimethylsilylethoxymethyl)triazol-4-yl]silane (PubChem CID 22031298) has the molecular formula C29H55N3OSi2Sn and a molecular weight of 636.66 g/mol. Its IUPAC name is trimethyl-[5-(4-tributylstannylphenyl)-3-(2-trimethylsilylethoxymethyl)triazol-4-yl]silane.
| Compound Name | trimethyl-[5-(4-tributylstannylphenyl)-3-(2-trimethylsilylethoxymethyl)triazol-4-yl]silane |
|---|---|
| PubChem CID | 22031298 |
| Molecular Formula | C29H55N3OSi2Sn |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | trimethyl-[5-(4-tributylstannylphenyl)-3-(2-trimethylsilylethoxymethyl)triazol-4-yl]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(-c2nnn(COCC[Si](C)(C)C)c2[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C17H28N3OSi2.3C4H9.Sn/c1-22(2,3)13-12-21-14-20-17(23(4,5)6)16(18-19-20)15-10-8-7-9-11-15;3*1-3-4-2;/h8-11H,12-14H2,1-6H3;3*1,3-4H2,2H3; |
| InChIKey | WQGCFKFAWXONEL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|