C21H43FN2OSiSn — CID 175449028
2-[(5-fluoro-4-tributylstannylpyrazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 175449028) has the molecular formula C21H43FN2OSiSn and a molecular weight of 505.38 g/mol. Its IUPAC name is 2-[(5-fluoro-4-tributylstannylpyrazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5-fluoro-4-tributylstannylpyrazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 175449028 |
| Molecular Formula | C21H43FN2OSiSn |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2-[(5-fluoro-4-tributylstannylpyrazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnn(COCC[Si](C)(C)C)c1F |
| InChI | InChI=1S/C9H16FN2OSi.3C4H9.Sn/c1-14(2,3)7-6-13-8-12-9(10)4-5-11-12;3*1-3-4-2;/h5H,6-8H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | DSCPCISTXUCHMV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|