C21H44N2OSiSn — CID 171532445
trimethyl-[2-[(5-tributylstannylimidazol-1-yl)methoxy]ethyl]silane (PubChem CID 171532445) has the molecular formula C21H44N2OSiSn and a molecular weight of 487.39 g/mol. Its IUPAC name is trimethyl-[2-[(5-tributylstannylimidazol-1-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(5-tributylstannylimidazol-1-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 171532445 |
| Molecular Formula | C21H44N2OSiSn |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | trimethyl-[2-[(5-tributylstannylimidazol-1-yl)methoxy]ethyl]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cncn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C9H17N2OSi.3C4H9.Sn/c1-13(2,3)7-6-12-9-11-5-4-10-8-11;3*1-3-4-2;/h4,8H,6-7,9H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | UAAFXXPKMQQUSE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|