C25H45N3OSiSn — CID 141241205
5-butylnonan-5-yl-[1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]tin (PubChem CID 141241205) has the molecular formula C25H45N3OSiSn and a molecular weight of 550.45 g/mol. Its IUPAC name is 5-butylnonan-5-yl-[1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]tin.
| Compound Name | 5-butylnonan-5-yl-[1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]tin |
|---|---|
| PubChem CID | 141241205 |
| Molecular Formula | C25H45N3OSiSn |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 5-butylnonan-5-yl-[1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1cnc2ncn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C13H27.C12H18N3OSi.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-17(2,3)8-7-16-10-15-9-14-12-11(15)5-4-6-13-12;/h4-12H2,1-3H3;5-6,9H,7-8,10H2,1-3H3; |
| InChIKey | AXRLZTYPTNJCBK-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|