About 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin
5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin (PubChem CID 141310885) has the molecular formula C32H58Sn2
and a molecular weight of 680.24 g/mol. Its IUPAC name is 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin.
Molecular Properties
| Compound Name | 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin |
| PubChem CID | 141310885 |
| Molecular Formula | C32H58Sn2 |
| Molecular Weight | 680.24 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1ccc([Sn]C(CCCC)(CCCC)CCCC)cc1 |
| InChI | InChI=1S/2C13H27.C6H4.2Sn/c2*1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-4-6-5-3-1;;/h2*4-12H2,1-3H3;1-2,5-6H;; |
| InChIKey | CGFUBBHGRJAQQL-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 680.24 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin?
The IUPAC name of 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin (CID 141310885) is 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin.
What is the SMILES notation for 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin?
The canonical SMILES for 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin is CCCCC(CCCC)(CCCC)[Sn]c1ccc([Sn]C(CCCC)(CCCC)CCCC)cc1.
What is the InChIKey of 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin?
The InChIKey is CGFUBBHGRJAQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H27.C6H4.2Sn/c2*1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-4-6-5-3-1;;/h2*4-12H2,1-3H3;1-2,5-6H;;.
What are the key properties of 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin?
5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin has a molecular weight of 680.24 g/mol, XLogP of 9.80, 22 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-yl-[4-(5-butylnonan-5-yl-λ2-stannanyl)phenyl]tin is sourced from PubChem (CID 141310885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).