About 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin
5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin (PubChem CID 140986624) has the molecular formula C20H32O2SSn
and a molecular weight of 455.25 g/mol. Its IUPAC name is 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin.
Molecular Properties
| Compound Name | 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin |
| PubChem CID | 140986624 |
| Molecular Formula | C20H32O2SSn |
| Molecular Weight | 455.25 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1sccc1C1OC=CO1 |
| InChI | InChI=1S/C13H27.C7H5O2S.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-4-10-5-6(1)7-8-2-3-9-7;/h4-12H2,1-3H3;1-4,7H; |
| InChIKey | QOVXVQCDQMGARB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.25 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin?
The IUPAC name of 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin (CID 140986624) is 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin.
What is the SMILES notation for 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin?
The canonical SMILES for 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin is CCCCC(CCCC)(CCCC)[Sn]c1sccc1C1OC=CO1.
What is the InChIKey of 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin?
The InChIKey is QOVXVQCDQMGARB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27.C7H5O2S.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-4-10-5-6(1)7-8-2-3-9-7;/h4-12H2,1-3H3;1-4,7H;.
What are the key properties of 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin?
5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin has a molecular weight of 455.25 g/mol, XLogP of 6.32, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-yl-[3-(1,3-dioxol-2-yl)thiophen-2-yl]tin is sourced from PubChem (CID 140986624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).