C21H34O3Sn — CID 140997584
5-butylnonan-5-yl-[5-(1,3-dioxol-2-ylmethyl)furan-2-yl]tin (PubChem CID 140997584) has the molecular formula C21H34O3Sn and a molecular weight of 453.21 g/mol. Its IUPAC name is 5-butylnonan-5-yl-[5-(1,3-dioxol-2-ylmethyl)furan-2-yl]tin.
| Compound Name | 5-butylnonan-5-yl-[5-(1,3-dioxol-2-ylmethyl)furan-2-yl]tin |
|---|---|
| PubChem CID | 140997584 |
| Molecular Formula | C21H34O3Sn |
| Molecular Weight | 453.21 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 5-butylnonan-5-yl-[5-(1,3-dioxol-2-ylmethyl)furan-2-yl]tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1ccc(CC2OC=CO2)o1 |
| InChI | InChI=1S/C13H27.C8H7O3.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-7(9-3-1)6-8-10-4-5-11-8;/h4-12H2,1-3H3;1-2,4-5,8H,6H2; |
| InChIKey | YJVUVHHCJRBGSO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.21 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |