About 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin
5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin (PubChem CID 176910575) has the molecular formula C25H49NOSiSn
and a molecular weight of 526.47 g/mol. Its IUPAC name is 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin.
Molecular Properties
| Compound Name | 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin |
| PubChem CID | 176910575 |
| Molecular Formula | C25H49NOSiSn |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1coc([Si](C(C)C)(C(C)C)C(C)C)n1 |
| InChI | InChI=1S/C13H27.C12H22NOSi.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-9(2)15(10(3)4,11(5)6)12-13-7-8-14-12;/h4-12H2,1-3H3;8-11H,1-6H3; |
| InChIKey | UNCUBQMXNRZTSZ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin?
The IUPAC name of 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin (CID 176910575) is 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin.
What is the SMILES notation for 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin?
The canonical SMILES for 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin is CCCCC(CCCC)(CCCC)[Sn]c1coc([Si](C(C)C)(C(C)C)C(C)C)n1.
What is the InChIKey of 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin?
The InChIKey is UNCUBQMXNRZTSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27.C12H22NOSi.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-9(2)15(10(3)4,11(5)6)12-13-7-8-14-12;/h4-12H2,1-3H3;8-11H,1-6H3;.
What are the key properties of 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin?
5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin has a molecular weight of 526.47 g/mol, XLogP of 7.62, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-yl-[2-tri(propan-2-yl)silyl-1,3-oxazol-4-yl]tin is sourced from PubChem (CID 176910575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).